missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenazine methosulfate, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210095505
Specifications
| Phenazine methosulfate | |
| Yellow | |
| 5 g | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 5-methylphenazin-5-ium;methyl sulfate | |
| 9285 | |
| 306.3 |
| 299-11-6 | |
| C14H14N2O4S | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] | |
| 306.336 | |
| CHEBI:8055 | |
| Crystals |
Chemical Identifiers
| 299-11-6 | |
| 306.336 | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| CHEBI:8055 | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| C14H14N2O4S | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 9285 | |
| 5-methylphenazin-5-ium;methyl sulfate |
Safety and Handling
Recommended Storage : Store at 2° to 8°C.