Learn More
Phenazine methosulfate, 98%
CAS: 299-11-6 | C13H11N2·CH3O4S | 306.33 g/mol
$101.33 - $1188.88
Chemical Identifiers
| CAS | 299-11-6 |
|---|---|
| Molecular Formula | C13H11N2·CH3O4S |
| Molecular Weight (g/mol) | 306.33 |
| MDL Number | MFCD00011923 |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Synonym | phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate |
| PubChem CID | 9285 |
| ChEBI | CHEBI:8055 |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130160010
|
Thermo Scientific Chemicals
130160010 |
1 g | Glass bottle |
Each for $101.33
|
|
||||
|
AC130160250
|
Thermo Scientific Chemicals
130160250 |
25 g | Glass bottle |
Each for $1,188.88
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 299-11-6 | |
| 306.33 | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 9285 | |
| 5-methylphenazin-5-ium;methyl sulfate |
| C13H11N2·CH3O4S | |
| MFCD00011923 | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| CHEBI:8055 | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
Specifications
| 299-11-6 | |
| Brown to Yellow or Khaki | |
| 98% | |
| C13H11N2·CH3O4S | |
| 1 g | |
| phenazine methosulfate, 5-methylphenazin-5-ium methyl sulfate, 5-methylphenazinium methyl sulfate, n-methylphenazonium methosulfate, phenazine methosulphate, methylphenazonium methosulfate, 5-methylphenazine methylsulfate, n-methylphenazinium methosulfate, n-methylphenazonium methosulphate, phenazinium, 5-methyl-, methyl sulfate | |
| RXGJTUSBYWCRBK-UHFFFAOYSA-M | |
| 5-methylphenazin-5-ium;methyl sulfate | |
| 9285 | |
| 306.33 | |
| Crystalline Powder |
| 158°C to 160°C | |
| Authentic | |
| Glass bottle | |
| MFCD00011923 | |
| 15, 6182 | |
| Solubility in water: soluble. Other solubilities: soluble in methanol and ethanol,insoluble in benzene and diethylether | |
| C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] | |
| 306.33 | |
| CHEBI:8055 | |
| 98% | |
| Phenazine methosulfate, 99% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
If eye irritation persists: Get medical advice/attention.
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/phys
GHS Signal Word: Warning
EINECSNumber : 206-072-1
RTECSNumber : SG1645000
TSCA : TSCA
RUO – Research Use Only