missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenanthrene Zone Refined (number of passes:30) 98.5+%, TCI America™
Supplier: TCI America P03311SAMPLE
Specifications
| Phenanthrene Zone Refined (number of passes:30) | |
| 100°C | |
| 340°C | |
| MFCD00001168 | |
| 3077 | |
| YNPNZTXNASCQKK-UHFFFAOYSA-N | |
| phenanthrene | |
| 995 | |
| 178.23 | |
| Crystalline Powder |
| 85-01-8 | |
| White | |
| C14H10 | |
| ZONE | |
| phenanthren, phenanthrin, phenanthracene, ravatite, phenantrin, phenanthren german, phenanthrene, pure, unii-448j8e5bst, ccris 1233, chembl46730 | |
| C1=CC=C2C(C=CC3=CC=CC=C23)=C1 | |
| 178.23 | |
| CHEBI:28851 | |
| ≥98.5% (GC) |
Chemical Identifiers
| 85-01-8 | |
| 178.23 | |
| YNPNZTXNASCQKK-UHFFFAOYSA-N | |
| 995 | |
| phenanthrene |
| C14H10 | |
| MFCD00001168 | |
| phenanthren, phenanthrin, phenanthracene, ravatite, phenantrin, phenanthren german, phenanthrene, pure, unii-448j8e5bst, ccris 1233, chembl46730 | |
| CHEBI:28851 | |
| C1=CC=C2C(C=CC3=CC=CC=C23)=C1 |
Safety and Handling
EINECSNumber : (4)-0635
RTECSNumber : SF7175000
TSCA : Yes