Learn More
Oxalic acid, potassium salt dihydrate, 99%, extra pure
CAS: 6100-20-5 | C4H3KO8 | 218.16 g/mol
Supplier: Thermo Scientific Chemicals 352115000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Oxalic acid, potassium salt dihydrate | |
| 6100-20-5 | |
| 12 % to 16 % (1 g, 105°C) | |
| 99% | |
| C4H3KO8 | |
| 500 g | |
| potassium trihydrogen dioxalate dihydrate, potassium ion oxalic acid dihydrate hydrogen oxalate, potassium oxalic acid dihydrate hydrogen oxalate | |
| GANDVAJEIJXBQJ-UHFFFAOYSA-M | |
| potassium;hydron;oxalate;dihydrate | |
| 131698588 | |
| 99% | |
| Crystalline Powder or Solid |
| 99% | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00150443,MFCD00150443 | |
| 15, 7806 | |
| Solubility in water: soluble. Other solubilities: insoluble in benzene, ethanol | |
| [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O | |
| 218.16 | |
| 254.2 | |
| Extra Pure |
Chemical Identifiers
| 6100-20-5 | |
| 218.16 | |
| GANDVAJEIJXBQJ-UHFFFAOYSA-M | |
| 131698588 | |
| [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O |
| C4H3KO8 | |
| MFCD00150443,MFCD00150443 | |
| potassium trihydrogen dioxalate dihydrate, potassium ion oxalic acid dihydrate hydrogen oxalate, potassium oxalic acid dihydrate hydrogen oxalate | |
| potassium;hydron;oxalate;dihydrate |
Safety and Handling
GHS H Statement
Harmful in contact with skin.
Harmful if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
RUO – Research Use Only