Learn More
Thermo Scientific Chemicals Orange II, pure
CAS: 633-96-5 | C16H11N2NaO4S | 350.324 g/mol
$61.22 - $177.21
Chemical Identifiers
| CAS | 633-96-5 |
|---|---|
| Molecular Formula | C16H11N2NaO4S |
| Molecular Weight (g/mol) | 350.324 |
| MDL Number | MFCD00011657 |
| InChI Key | IGQFKZCLTLAWLO-UHFFFAOYSA-M |
| Synonym | Acid Orange 7, C.I. 15510, p-(2-Hydroxy-1-naphthylazo)benzenesulfonic acid, sodium salt |
| PubChem CID | 44135675 |
| IUPAC Name | sodium;4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate |
| SMILES | C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|
AC416560250
|
Thermo Scientific Chemicals
416560250 |
25 g | Glass bottle |
Each for $61.22
|
|
||||
|
AC416561000
|
Thermo Scientific Chemicals
416561000 |
100 g | Glass bottle |
Each for $177.21
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 633-96-5 | |
| 350.324 | |
| IGQFKZCLTLAWLO-UHFFFAOYSA-M | |
| 44135675 | |
| C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] |
| C16H11N2NaO4S | |
| MFCD00011657 | |
| Acid Orange 7, C.I. 15510, p-(2-Hydroxy-1-naphthylazo)benzenesulfonic acid, sodium salt | |
| sodium;4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate |
Specifications
| 164.0°C | |
| 0.93 to 0.98 (P-15/P+15) | |
| 85% min. | |
| MFCD00011657 | |
| 15, 6953 | |
| Solubility in water: 116g/L (30°C). | |
| C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] | |
| sodium;4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]benzenesulfonate | |
| 44135675 | |
| 350.32 | |
| Blue to Green | |
| Orange II, Pure |
| 633-96-5 | |
| Pass | |
| C16H11N2NaO4S | |
| 16, 274 | |
| Acid Orange 7, C.I. 15510, p-(2-Hydroxy-1-naphthylazo)benzenesulfonic acid, sodium salt | |
| IGQFKZCLTLAWLO-UHFFFAOYSA-M | |
| Authentic | |
| 350.324 | |
| 480 to 486nm (c=0.01 g/l, H2O) | |
| Pure | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes damage to organs through prolonged or repeated exposure if inhaled.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Do not breathe dust/fume/gas/mist/vapors/spray.
Get medical attention/advice if you feel unwell.
Warning
RUO – Research Use Only