Learn More
Oleic acid, 97%
CAS: 112-80-1 | C18H34O2 | 282.47 g/mol
Supplier: Thermo Scientific Chemicals 270290050
| Quantity | 5 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| C18H34O2 | |
| MFCD00064242 | |
| oleic acid, cis-9-octadecenoic acid, cis-oleic acid, elaidoic acid, oleate, glycon wo, wecoline oo, pamolyn 100, glycon ro, z-octadec-9-enoic acid | |
| CHEBI:16196 | |
| CCCCCCCC\C=C\CCCCCCCC(O)=O |
Specifications
| Oleic acid | |
| 13.0°C | |
| 0.8900g/mL | |
| 189°C | |
| 96% min. (GC) | |
| C18H34O2 | |
| 1.4585 to 1.4605 | |
| MFCD00064242 | |
| 01,759 | |
| 0.89 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol, benzene, chloroform, ether,, fixed and volatile oils | |
| CCCCCCCC\C=C\CCCCCCCC(O)=O | |
| 282.47 | |
| 39.1 mPa.s (20°C) | |
| 282.46 | |
| Liquid |
| 112-80-1 | |
| Colorless | |
| 360.0°C | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)7CH=CH(CH2)7COOH | |
| 5 g | |
| 02,463 | |
| 15,6921 | |
| oleic acid, cis-9-octadecenoic acid, cis-oleic acid, elaidoic acid, oleate, glycon wo, wecoline oo, pamolyn 100, glycon ro, z-octadec-9-enoic acid | |
| ZQPPMHVWECSIRJ-MDZDMXLPSA-N | |
| (Z)-octadec-9-enoic acid | |
| 445639 | |
| CHEBI:16196 | |
| 97% |
Safety and Handling
GHS P Statement May cause respiratory irritation. Causes serious eye irritation. Causes skin irritation.
GHS P Statement Avoid breathing dust/fume/gas/mist/vapors/spray. Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Warning
EINECSNumber : 204-007-1
Recommended Storage : −20°C