Learn More
Ofloxacin
Fluorinated nalidixic acid analog with broad-spectrum antibacterial activity | CAS: 82419-36-1 | C18H20FN3O4 | 361.373 g/mol
Supplier: Thermo Scientific Chemicals J6208003
| Quantity | 1 g |
|---|
Description
Fluorinated nalidixic acid analog with broad-spectrum antibacterial activity
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 82419-36-1 | |
| 361.373 | |
| GSDSWSVVBLHKDQ-UHFFFAOYSA-N | |
| 4583 | |
| CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)O |
| C18H20FN3O4 | |
| MFCD00226105 | |
| Oflocet; Ofloxacine | |
| CHEBI:7731 |
Specifications
| Ofloxacin | |
| Crystalline Powder | |
| 270°C to 275°C | |
| 1 g | |
| MFCD00226105 | |
| Oflocet; Ofloxacine | |
| GSDSWSVVBLHKDQ-UHFFFAOYSA-N | |
| 361.373 | |
| CHEBI:7731 |
| Ofloxacin | |
| 82419-36-1 | |
| White to Yellow | |
| C18H20FN3O4 | |
| 14,6771 | |
| Soluble in acetic acid or water; Slightly soluble in methanol | |
| CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)O | |
| 4583 | |
| 361.37 |
Safety and Handling
RTECSNumber : UU8815500
TSCA : No
Recommended Storage : Store at -20°C