missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Octyl 4-methoxycinnamate, 98%, stabilized
CAS: 5466-77-3 | C18H26O3 | 290.40 g/mol
Supplier: Thermo Scientific Chemicals 291161000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Octyl 4-methoxycinnamate | |
| 1mg KOH/g max. | |
| Colorless to Yellow | |
| 193°C | |
| 97.5% min. (GC) | |
| C18H26O3 | |
| MFCD00072582 | |
| 1.009 | |
| bidd:er0152, octyl methoxy cinnamate omc, unii-4y5p7mud51 component, 2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate | |
| CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1 | |
| 290.40 | |
| 11044481 | |
| 98% |
| 5466-77-3 | |
| 830 (at 307 to 308nm in methanol) min. | |
| 1.0090g/mL | |
| Authentic | |
| Glass bottle | |
| 1.5430 to 1.5470 | |
| 100 g | |
| 15,6859 | |
| YBGZDTIWKVFICR-UHFFFAOYNA-N | |
| [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate | |
| 0.05 to 0.1% BHT | |
| 290.39 | |
| Liquid |
Chemical Identifiers
| 5466-77-3 | |
| 290.40 | |
| YBGZDTIWKVFICR-UHFFFAOYNA-N | |
| 11044481 | |
| CCCCC(CC)COC(=O)C=CC1=CC=C(OC)C=C1 |
| C18H26O3 | |
| MFCD00072582 | |
| bidd:er0152, octyl methoxy cinnamate omc, unii-4y5p7mud51 component, 2s-2-ethylhexyl 2e-3-4-methoxyphenyl prop-2-enoate | |
| [(2S)-2-ethylhexyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
Safety and Handling
EINECSNumber : 226-775-7
RUO – Research Use Only