Learn More
Octamethylcyclotetrasiloxane, 98%
CAS: 556-67-2 | C8H24O4Si4 | 296.61 g/mol
$85.05 - $571.24
Chemical Identifiers
| CAS | 556-67-2 |
|---|---|
| Molecular Formula | C8H24O4Si4 |
| Molecular Weight (g/mol) | 296.61 |
| MDL Number | MFCD00003269 |
| InChI Key | HMMGMWAXVFQUOA-UHFFFAOYSA-N |
| Synonym | octamethylcyclotetrasiloxane, cyclotetrasiloxane, octamethyl, oktamethylcyklotetrasiloxan, cyclic dimethylsiloxane tetramer, omcts, nuc silicone vs 7207, union carbide 7207, silicone sf 1173, oktamethylzyklotetrasiloxan, unii-cz227117je |
| PubChem CID | 11169 |
| ChEBI | CHEBI:25640 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC216470250
|
Thermo Scientific Chemicals
216470250 |
25 g | Glass bottle |
Each for $85.05
|
|
||||
|
AC216471000
|
Thermo Scientific Chemicals
216471000 |
100 g | Glass bottle |
Each for $193.87
|
|
||||
|
AC216475000
|
Thermo Scientific Chemicals
216475000 |
500 g | Glass bottle |
Each for $571.24
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 556-67-2 | |
| 296.61 | |
| HMMGMWAXVFQUOA-UHFFFAOYSA-N | |
| 11169 | |
| 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| C8H24O4Si4 | |
| MFCD00003269 | |
| octamethylcyclotetrasiloxane, cyclotetrasiloxane, octamethyl, oktamethylcyklotetrasiloxan, cyclic dimethylsiloxane tetramer, omcts, nuc silicone vs 7207, union carbide 7207, silicone sf 1173, oktamethylzyklotetrasiloxan, unii-cz227117je | |
| CHEBI:25640 | |
| C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)C |
Specifications
| 556-67-2 | |
| 100.0 | |
| Colorless | |
| 175.0°C to 176.0°C | |
| Authentic | |
| Glass bottle | |
| 1.3950 to 1.3970 | |
| 25 g | |
| 0.956 | |
| octamethylcyclotetrasiloxane, cyclotetrasiloxane, octamethyl, oktamethylcyklotetrasiloxan, cyclic dimethylsiloxane tetramer, omcts, nuc silicone vs 7207, union carbide 7207, silicone sf 1173, oktamethylzyklotetrasiloxan, unii-cz227117je | |
| HMMGMWAXVFQUOA-UHFFFAOYSA-N | |
| 2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane | |
| 11169 | |
| 296.61 | |
| Liquid |
| 97.5 | |
| 17.0°C to 18.0°C | |
| 0.9560g/mL | |
| 56°C | |
| 98% | |
| C8H24O4Si4 | |
| MFCD00003269 | |
| 04, III, 1885 | |
| 15, 6836 | |
| Solubility in water: insoluble. Other solubilities: soluble in carbon tetrachloride | |
| C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)C | |
| 296.61 | |
| CHEBI:25640 | |
| 98% | |
| Octamethylcyclotetrasiloxane |
Safety and Handling
GHS H Statement
Suspected of damaging fertility.
May cause long lasting harmful effects to aquatic life.
Flammable liquid and vapor.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
Obtain special instructions before use.
IF exposed or concerned: Get medical advice/at
GHS Signal Word: Warning
EINECSNumber : 209-136-7
RUO – Research Use Only