Learn More
o-Phthaloyl dichloride, 90%, remainder mainly phthalic acid, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 131110050
| Quantity | 5mL |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C8H4Cl2O2 | |
| MFCD00000666 | |
| phthaloyl chloride, phthaloyl dichloride, phthalic chloride, phthalyl chloride, phthalic dichloride, phthalic acid dichloride, phthalyl dichloride, 1,2-benzenedicarbonyl dichloride, o-phthaloyl dichloride, phthaloyldichloride | |
| benzene-1,2-dicarbonyl chloride |
Specifications
| o-Phthaloyl dichloride | |
| 88-95-9 | |
| 269.0°C to 271.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5674 to 1.5694 | |
| 5mL | |
| 09, 805 | |
| 1.4 | |
| phthaloyl chloride, phthaloyl dichloride, phthalic chloride, phthalyl chloride, phthalic dichloride, phthalic acid dichloride, phthalyl dichloride, 1,2-benzenedicarbonyl dichloride, o-phthaloyl dichloride, phthaloyldichloride | |
| FYXKZNLBZKRYSS-UHFFFAOYSA-N | |
| benzene-1,2-dicarbonyl chloride | |
| 6955 | |
| 90% |
| Remainder mainly phthalic acid | |
| 1.4000g/mL | |
| 113°C | |
| 90% | |
| C8H4Cl2O2 | |
| C6H4(COCl)2 | |
| MFCD00000666 | |
| 01,882; 14,263 | |
| 15, 7487 | |
| Solubility in water: decomposes. Other solubilities: soluble in ether, decomposes in alcohol | |
| C1=CC=C(C(=C1)C(=O)Cl)C(=O)Cl | |
| 203.02 | |
| 203.02 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Harmful in contact with skin.
May cause an allergic skin reaction.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
May cause respiratory ir
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 201-869-