missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific™ O-Methyl-L-tyrosine, 98%
Supplier: Thermo Scientific™ 169750050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| O-Methyl-L-tyrosine | |
| 97.5 | |
| Authentic | |
| C10H13NO3 | |
| CH3OC6H4CH2CH(NH2)CO2H | |
| -7° to -9° (20°C, 589nm) (c=2, 1N HCl) | |
| 4-methoxy-l-phenylalanine, o-methyl-l-tyrosine, h-tyr me-oh, o-methyltyrosine, s-2-amino-3-4-methoxyphenyl propanoic acid, p-methoxy-l-phenylalanine, 2s-2-amino-3-4-methoxyphenyl propanoic acid, tyrosine, o-methyl, l-4-methoxyphenylalanine, h-4-methoxy-phe-oh | |
| COC1=CC=C(C=C1)CC(C(=O)O)N | |
| −8° (20°C c=2,1N HCl) | |
| 195.22 | |
| 195.22 |
| 6230-11-1 | |
| 100.0 | |
| 98% | |
| Glass bottle | |
| MFCD00002604 | |
| 14, I, 668 | |
| GEYBMYRBIABFTA-UHFFFAOYNA-N | |
| (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid | |
| 5g | |
| 2723935 | |
| ≥97.5% |
Chemical Identifiers
| 6230-11-1 | |
| 195.22 | |
| GEYBMYRBIABFTA-UHFFFAOYNA-N | |
| 2723935 | |
| COC1=CC=C(C=C1)CC(C(=O)O)N |
| C10H13NO3 | |
| MFCD00002604 | |
| 4-methoxy-l-phenylalanine, o-methyl-l-tyrosine, h-tyr me-oh, o-methyltyrosine, s-2-amino-3-4-methoxyphenyl propanoic acid, p-methoxy-l-phenylalanine, 2s-2-amino-3-4-methoxyphenyl propanoic acid, tyrosine, o-methyl, l-4-methoxyphenylalanine, h-4-methoxy-phe-oh | |
| (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid |
RUO â Research Use Only