missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Norfloxacin, 98%, Analytical standard, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 445260050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Norfloxacin | |
| Crystalline Powder | |
| 218°C to 226°C | |
| Authentic | |
| White to Yellow | |
| 98% | |
| 1-Ethyl-6-fluoro-1, 4-dihydro-4-oxo-7-piperazino-3-quinolinecarboxylic acid | |
| CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O | |
| 319.336 | |
| CHEBI:100246 | |
| ≥97.5% (HPLC) |
| Norfloxacin | |
| 70458-96-7 | |
| 0.2 % max. | |
| 3% Max. (K.F.) | |
| 5 g | |
| C16H18FN3O3 | |
| OGJPXUAPXNRGGI-UHFFFAOYSA-N | |
| 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | |
| 4539 | |
| 319.34 |
Chemical Identifiers
| 70458-96-7 | |
| 319.336 | |
| 1-Ethyl-6-fluoro-1, 4-dihydro-4-oxo-7-piperazino-3-quinolinecarboxylic acid | |
| CHEBI:100246 | |
| CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O |
| C16H18FN3O3 | |
| OGJPXUAPXNRGGI-UHFFFAOYSA-N | |
| 4539 | |
| 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
RUO – Research Use Only