missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Nonidet™ P40 Substitute, Ultrapure, Thermo Scientific Chemicals
Supplier: Thermo Fisher Scientific J19628K2
| Quantity | 1 L |
|---|---|
| Packaging | Plastic bottle |
Chemical Identifiers
| C16H26O2 | |
| MFCD00132505 | |
| Igepal CA to 630,Polyethylene glycol tert to octylphenyl ether | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol |
Specifications
| Nonidet™ P40 Substitute | |
| Viscous Liquid | |
| ∼5°C | |
| 1 L | |
| Plastic bottle | |
| C16H26O2 | |
| Igepal CA to 630,Polyethylene glycol tert to octylphenyl ether | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 | |
| 250.38 | |
| ca 625 |
| 9002-93-1 | |
| >250°C | |
| 1.061 | |
| >110°C | |
| 1.061 | |
| MFCD00132505 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol | |
| 5590 |
Safety and Handling
P264b-P270-P280-P301+P312-P305+P351+P338-P310-P330-P501c
H302-H318
RTECSNumber : MD0907600
TSCA : Yes
Recommended Storage : Ambient temperatures