missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Nimodipine, MP Biomedicals™
$78.05 - $109.70
Chemical Identifiers
| CAS | 66085-59-4 |
|---|---|
| Molecular Formula | C21H26N2O7 |
| Molecular Weight (g/mol) | 418.446 |
| InChI Key | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| Synonym | admon, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate, nimodipine, nimodipino, nimodipino inn-spanish, nimodipinum, nimodipinum inn-latin, nimotop, nymalize, periplum |
| PubChem CID | 4497 |
| ChEBI | CHEBI:7575 |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15980325
|
Mp Biomedicals
15980325 |
25mg |
Each for $78.05
|
|
ICN15980380
|
Mp Biomedicals
15980380 |
100mg |
Each for $109.70
|
|
Chemical Identifiers
| 66085-59-4 | |
| 418.446 | |
| admon, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate, nimodipine, nimodipino, nimodipino inn-spanish, nimodipinum, nimodipinum inn-latin, nimotop, nymalize, periplum | |
| CHEBI:7575 | |
| CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
| C21H26N2O7 | |
| UIAGMCDKSXEBJQ-UHFFFAOYSA-N | |
| 4497 | |
| 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
Specifications
| Yellow | |
| 66085-59-4 | |
| admon, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate, nimodipine, nimodipino, nimodipino inn-spanish, nimodipinum, nimodipinum inn-latin, nimotop, nymalize, periplum | |
| CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC | |
| 418.446 | |
| CHEBI:7575 | |
| Solid |
| 25mg | |
| C21H26N2O7 | |
| UIAGMCDKSXEBJQ-UHFFFAOYSA-N | |
| 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | |
| 4497 | |
| 418.4 | |
| Nimodipine |
Safety and Handling
storageNote1 : Protect from light
Recommended Storage : Store at room temperature (15° to 30°C)