missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
β-Nicotinamide adenine dinucleotide, reduced, disodium salt, >99%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210116801
Specifications
| β-Nicotinamide adenine dinucleotide, reduced, disodium salt | |
| White to Yellow | |
| C21H27N7Na2O14P2 | |
| 1 g | |
| QRGNQKGQENGQSE-WUEGHLCSSA-L | |
| [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium | |
| 131673989 | |
| Powder |
| 606-68-8 | |
| >99% | |
| MFCD00036200 | |
| beta-nadh disodium salt | |
| [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O | |
| 709.41 | |
| 709.4 |
Chemical Identifiers
| 606-68-8 | |
| 709.41 | |
| QRGNQKGQENGQSE-WUEGHLCSSA-L | |
| 131673989 | |
| [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| C21H27N7Na2O14P2 | |
| MFCD00036200 | |
| beta-nadh disodium salt | |
| [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |