missing translation for 'onlineSavingsMsg'
Learn More
Learn More
beta-Nicotinamide adenine dinucleotide hydrate, 98+%
CAS: 53-84-9 | C21H27N7O14P2 | 663.43 g/mol
Supplier: Thermo Scientific Chemicals 124530050
| Quantity | 5 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 53-84-9 | |
| 663.43 | |
| BAWFJGJZGIEFAR-WIWLTUSXNA-N | |
| 15938971 | |
| [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| C21H27N7O14P2 | |
| MFCD00150377 | |
| nicotinamide adenine dinucleotide, nad+, diphosphopyridine nucleotide, nad-oxidized, nicotinamide-adenine dinucleotide, dpn-ox, beta-nicotinamide adenine dinucleotide, dpn+, nad, nad + | |
| CHEBI:57540 | |
| NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
Specifications
| β-Nicotinamide adenine dinucleotide hydrate | |
| 98.0 | |
| 98+% | |
| C21H27N7O14P2 | |
| 5 g | |
| nicotinamide adenine dinucleotide, nad+, diphosphopyridine nucleotide, nad-oxidized, nicotinamide-adenine dinucleotide, dpn-ox, beta-nicotinamide adenine dinucleotide, dpn+, nad, nad + | |
| BAWFJGJZGIEFAR-WIWLTUSXNA-N | |
| [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate | |
| 15938971 | |
| 663.43 | |
| Crystalline |
| 53-84-9 | |
| 100.0 | |
| Glass bottle | |
| MFCD00150377 | |
| 15, 6429 | |
| (1% in water) Clear colorless | |
| NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O | |
| 663.43 | |
| CHEBI:57540 | |
| 98+% |
Safety and Handling
EINECSNumber : 200-184-4