missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals N-omega-Nitro-L-arginine-methyl ester hydrochloride, 98%
CAS: 51298-62-5 | C7H16ClN5O4 | 269.69 g/mol
$302.93 - $302.93
Chemical Identifiers
| CAS | 51298-62-5 |
|---|---|
| Molecular Formula | C7H16ClN5O4 |
| Molecular Weight (g/mol) | 269.69 |
| MDL Number | MFCD00039052,MFCD00133613 |
| InChI Key | QBNXAGZYLSRPJK-JEDNCBNOSA-N |
| Synonym | h-arg no2-ome.hcl, lname hydrochloride, l-name hydrochloride, ng-nitro-l-arginine methyl ester hydrochloride, nomega-nitro-l-arginine methyl ester hydrochloride, s-methyl 2-amino-5-3-nitroguanidino pentanoate hydrochloride, l-name, hcl, ng-no2-l-arg-ome, nomega-no2-l-arg-ome |
| PubChem CID | 135193 |
| IUPAC Name | methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride |
| SMILES | [H+].[Cl-].COC(=O)[C@@H](N)CCCN=C(N)N[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC328750050
|
Thermo Scientific Chemicals
328750050 |
5 g | Glass Bottle |
Each for $302.93
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 51298-62-5 | |
| 269.69 | |
| QBNXAGZYLSRPJK-JEDNCBNOSA-N | |
| 135193 | |
| [H+].[Cl-].COC(=O)[C@@H](N)CCCN=C(N)N[N+]([O-])=O |
| C7H16ClN5O4 | |
| MFCD00039052,MFCD00133613 | |
| h-arg no2-ome.hcl, lname hydrochloride, l-name hydrochloride, ng-nitro-l-arginine methyl ester hydrochloride, nomega-nitro-l-arginine methyl ester hydrochloride, s-methyl 2-amino-5-3-nitroguanidino pentanoate hydrochloride, l-name, hcl, ng-no2-l-arg-ome, nomega-no2-l-arg-ome | |
| methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride |
Specifications
| 51298-62-5 | |
| 100.0 | |
| Authentic | |
| C7H16ClN5O4 | |
| MFCD00039052,MFCD00133613 | |
| h-arg no2-ome.hcl, lname hydrochloride, l-name hydrochloride, ng-nitro-l-arginine methyl ester hydrochloride, nomega-nitro-l-arginine methyl ester hydrochloride, s-methyl 2-amino-5-3-nitroguanidino pentanoate hydrochloride, l-name, hcl, ng-no2-l-arg-ome, nomega-no2-l-arg-ome | |
| [H+].[Cl-].COC(=O)[C@@H](N)CCCN=C(N)N[N+]([O-])=O | |
| + 14.50 (20.00°C c=3,CH3OH) | |
| 269.69 | |
| 269.7 | |
| Crystalline Solid |
| 97.5 | |
| White | |
| 98% | |
| Glass Bottle | |
| +14.0° to +16.0° (24°C, 589nm) (c=3, CH3OH) | |
| QBNXAGZYLSRPJK-JEDNCBNOSA-N | |
| methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride | |
| 5 g | |
| 135193 | |
| ≥97.5% | |
| N-ω-Nitro-L-arginine-methyl ester hydrochloride |
RUO – Research Use Only