missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals N-omega-Nitro-L-arginine-methyl ester hydrochloride, 98%
CAS: 51298-62-5 | C7H16ClN5O4 | 269.69 g/mol
Supplier: Thermo Scientific Chemicals 328750050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| N-ω-Nitro-L-arginine-methyl ester hydrochloride | |
| 97.5 | |
| White | |
| 98% | |
| Glass Bottle | |
| +14.0° to +16.0° (24°C, 589nm) (c=3, CH3OH) | |
| QBNXAGZYLSRPJK-JEDNCBNOSA-N | |
| methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride | |
| 5 g | |
| 135193 | |
| ≥97.5% |
| 51298-62-5 | |
| 100.0 | |
| Authentic | |
| C7H16ClN5O4 | |
| MFCD00039052,MFCD00133613 | |
| h-arg no2-ome.hcl, lname hydrochloride, l-name hydrochloride, ng-nitro-l-arginine methyl ester hydrochloride, nomega-nitro-l-arginine methyl ester hydrochloride, s-methyl 2-amino-5-3-nitroguanidino pentanoate hydrochloride, l-name, hcl, ng-no2-l-arg-ome, nomega-no2-l-arg-ome | |
| [H+].[Cl-].COC(=O)[C@@H](N)CCCN=C(N)N[N+]([O-])=O | |
| + 14.50 (20.00°C c=3,CH3OH) | |
| 269.69 | |
| 269.7 | |
| Crystalline Solid |
Chemical Identifiers
| 51298-62-5 | |
| 269.69 | |
| QBNXAGZYLSRPJK-JEDNCBNOSA-N | |
| 135193 | |
| [H+].[Cl-].COC(=O)[C@@H](N)CCCN=C(N)N[N+]([O-])=O |
| C7H16ClN5O4 | |
| MFCD00039052,MFCD00133613 | |
| h-arg no2-ome.hcl, lname hydrochloride, l-name hydrochloride, ng-nitro-l-arginine methyl ester hydrochloride, nomega-nitro-l-arginine methyl ester hydrochloride, s-methyl 2-amino-5-3-nitroguanidino pentanoate hydrochloride, l-name, hcl, ng-no2-l-arg-ome, nomega-no2-l-arg-ome | |
| methyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;hydrochloride |
RUO – Research Use Only