Learn More
Neocuproine hemihydrate, 99+%
CAS: 34302-69-7 | C28H26N4O | 434.54 g/mol
$163.04 - $544.59
Chemical Identifiers
| CAS | 34302-69-7 |
|---|---|
| Molecular Formula | C28H26N4O |
| Molecular Weight (g/mol) | 434.54 |
| MDL Number | MFCD00149306,MFCD00004973,MFCD00149306,MFCD23140843 |
| InChI Key | IEBXFSLFDFHSRD-UHFFFAOYSA-N |
| Synonym | unii-2sdt9ev86w, 2sdt9ev86w, neocuproine hemihydrate mi, 1,10-phenanthroline, 2,9-dimethyl-, hemihydrate, 1,10-phenanthroline, 2,9-dimethyl-, hydrate 2:1, 2,9-dimethyl-1,10-phenthroline hemihydrate |
| PubChem CID | 67652146 |
| SMILES | O.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC153320050
|
Thermo Scientific Chemicals
153320050 |
5 g | Glass bottle |
Each for $163.04
|
|
||||
|
AC153320250
|
Thermo Scientific Chemicals
153320250 |
25 g | Glass bottle |
Each for $544.59
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 34302-69-7 | |
| 434.54 | |
| IEBXFSLFDFHSRD-UHFFFAOYSA-N | |
| 67652146 |
| C28H26N4O | |
| MFCD00149306,MFCD00004973,MFCD00149306,MFCD23140843 | |
| unii-2sdt9ev86w, 2sdt9ev86w, neocuproine hemihydrate mi, 1,10-phenanthroline, 2,9-dimethyl-, hemihydrate, 1,10-phenanthroline, 2,9-dimethyl-, hydrate 2:1, 2,9-dimethyl-1,10-phenthroline hemihydrate | |
| O.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1 |
Specifications
| 34302-69-7 | |
| 100.0 | |
| White | |
| 99% min. (Total base) | |
| C28H26N4O | |
| 5 g | |
| unii-2sdt9ev86w, 2sdt9ev86w, neocuproine hemihydrate mi, 1,10-phenanthroline, 2,9-dimethyl-, hemihydrate, 1,10-phenanthroline, 2,9-dimethyl-, hydrate 2:1, 2,9-dimethyl-1,10-phenthroline hemihydrate | |
| IEBXFSLFDFHSRD-UHFFFAOYSA-N | |
| bis(2,9-dimethyl-1,10-phenanthroline) hydrate | |
| 67652146 | |
| 99+% | |
| Neocuproine hemihydrate |
| 99.0 | |
| 158.0°C to 163.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00149306,MFCD00004973,MFCD00149306,MFCD23140843 | |
| 15, 6534 | |
| Solubility in water: slightly soluble. Other solubilities: 1500g/L methanol (20°C) | |
| O.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1 | |
| 434.54 | |
| 217.27 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF INHALED: Remove victim to fresh air and k
GHS Signal Word: Warning
RUO – Research Use Only