missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Phenylbenzylamine, 99%
CAS: 103-32-2 | C13H13N | 183.25 g/mol
$335.70 - $335.70
Chemical Identifiers
| CAS | 103-32-2 |
|---|---|
| Molecular Formula | C13H13N |
| Molecular Weight (g/mol) | 183.25 |
| MDL Number | MFCD00003018 |
| InChI Key | GTWJETSWSUWSEJ-UHFFFAOYSA-N |
| Synonym | n-phenylbenzylamine, benzylaniline, benzenemethanamine, n-phenyl, phenylbenzylamine, benzylphenylamine, n-monobenzylaniline, aniline, n-benzyl, benzylamine, n-phenyl, benzenamine, n-phenylmethyl, n-benzyl aniline |
| PubChem CID | 66028 |
| IUPAC Name | N-benzylaniline |
| SMILES | C1=CC=C(C=C1)CNC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC417391000
|
Thermo Scientific Chemicals
417391000 |
100 g | Glass bottle |
Each for $335.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 103-32-2 | |
| 183.25 | |
| GTWJETSWSUWSEJ-UHFFFAOYSA-N | |
| 66028 | |
| C1=CC=C(C=C1)CNC2=CC=CC=C2 |
| C13H13N | |
| MFCD00003018 | |
| n-phenylbenzylamine, benzylaniline, benzenemethanamine, n-phenyl, phenylbenzylamine, benzylphenylamine, n-monobenzylaniline, aniline, n-benzyl, benzylamine, n-phenyl, benzenamine, n-phenylmethyl, n-benzyl aniline | |
| N-benzylaniline |
Specifications
| 103-32-2 | |
| 100.0 | |
| Beige-Yellow to Colorless | |
| 306°C to 307°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2NHC6H5 | |
| 100 g | |
| 1.06 | |
| n-phenylbenzylamine, benzylaniline, benzenemethanamine, n-phenyl, phenylbenzylamine, benzylphenylamine, n-monobenzylaniline, aniline, n-benzyl, benzylamine, n-phenyl, benzenamine, n-phenylmethyl, n-benzyl aniline | |
| GTWJETSWSUWSEJ-UHFFFAOYSA-N | |
| N-benzylaniline | |
| 66028 | |
| 99% | |
| N-Phenylbenzylamine |
| 98.5 | |
| 34°C to 38°C | |
| 1.0600g/mL | |
| 152°C | |
| 98.5% min. (GC) | |
| C13H13N | |
| MFCD00003018 | |
| 12, 1023 | |
| 15, 1129 | |
| Solubility in water: insoluble in water. Other solubilities: very soluble in ethanol,ether,soluble in chloroform | |
| C1=CC=C(C=C1)CNC2=CC=CC=C2 | |
| 183.25 | |
| 183.25 | |
| Crystalline Powder or Low Melting Mass |
Safety and Handling
EINECSNumber : 203-100-4
RUO – Research Use Only