missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Phenylbenzylamine, 99%
CAS: 103-32-2 | C13H13N | 183.25 g/mol
Supplier: Thermo Scientific Chemicals 417391000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| N-Phenylbenzylamine | |
| 98.5 | |
| 34°C to 38°C | |
| 1.0600g/mL | |
| 152°C | |
| 98.5% min. (GC) | |
| C13H13N | |
| MFCD00003018 | |
| 12, 1023 | |
| 15, 1129 | |
| Solubility in water: insoluble in water. Other solubilities: very soluble in ethanol,ether,soluble in chloroform | |
| C1=CC=C(C=C1)CNC2=CC=CC=C2 | |
| 183.25 | |
| 183.25 | |
| Crystalline Powder or Low Melting Mass |
| 103-32-2 | |
| 100.0 | |
| Beige-Yellow to Colorless | |
| 306°C to 307°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2NHC6H5 | |
| 100 g | |
| 1.06 | |
| n-phenylbenzylamine, benzylaniline, benzenemethanamine, n-phenyl, phenylbenzylamine, benzylphenylamine, n-monobenzylaniline, aniline, n-benzyl, benzylamine, n-phenyl, benzenamine, n-phenylmethyl, n-benzyl aniline | |
| GTWJETSWSUWSEJ-UHFFFAOYSA-N | |
| N-benzylaniline | |
| 66028 | |
| 99% |
Chemical Identifiers
| 103-32-2 | |
| 183.25 | |
| GTWJETSWSUWSEJ-UHFFFAOYSA-N | |
| 66028 | |
| C1=CC=C(C=C1)CNC2=CC=CC=C2 |
| C13H13N | |
| MFCD00003018 | |
| n-phenylbenzylamine, benzylaniline, benzenemethanamine, n-phenyl, phenylbenzylamine, benzylphenylamine, n-monobenzylaniline, aniline, n-benzyl, benzylamine, n-phenyl, benzenamine, n-phenylmethyl, n-benzyl aniline | |
| N-benzylaniline |
Safety and Handling
EINECSNumber : 203-100-4
RUO – Research Use Only