missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Phenyl-2-naphthylamine, 97%
CAS: 135-88-6 | C16H13N | 219.29 g/mol
$105.70 - $105.70
Chemical Identifiers
| CAS | 135-88-6 |
|---|---|
| Molecular Formula | C16H13N |
| Molecular Weight (g/mol) | 219.29 |
| MDL Number | MFCD00004052 |
| InChI Key | KEQFTVQCIQJIQW-UHFFFAOYSA-N |
| Synonym | n-phenyl-2-naphthylamine, n-2-naphthyl aniline, neozone, aceto pbn, stabilizator ar, agerite powder, anilinonaphthalene, antioxidant 116, pbna, 2-naphthylphenylamine |
| PubChem CID | 8679 |
| ChEBI | CHEBI:34877 |
| IUPAC Name | N-phenylnaphthalen-2-amine |
| SMILES | N(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC439910250
|
Thermo Scientific Chemicals
439910250 |
25 g | Glass bottle |
Each for $105.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 135-88-6 | |
| 219.29 | |
| KEQFTVQCIQJIQW-UHFFFAOYSA-N | |
| 8679 | |
| N-phenylnaphthalen-2-amine |
| C16H13N | |
| MFCD00004052 | |
| n-phenyl-2-naphthylamine, n-2-naphthyl aniline, neozone, aceto pbn, stabilizator ar, agerite powder, anilinonaphthalene, antioxidant 116, pbna, 2-naphthylphenylamine | |
| CHEBI:34877 | |
| N(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1 |
Specifications
| 135-88-6 | |
| 395°C | |
| Glass bottle | |
| MFCD00004052 | |
| n-phenyl-2-naphthylamine, n-2-naphthyl aniline, neozone, aceto pbn, stabilizator ar, agerite powder, anilinonaphthalene, antioxidant 116, pbna, 2-naphthylphenylamine | |
| KEQFTVQCIQJIQW-UHFFFAOYSA-N | |
| N-phenylnaphthalen-2-amine | |
| 8679 | |
| 219.28 | |
| N-Phenyl-2-naphthylamine |
| 105°C to 108°C | |
| 96% min. (HPLC) | |
| C16H13N | |
| 25 g | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether,benzene,acetone,acetic acid | |
| N(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1 | |
| 219.29 | |
| CHEBI:34877 | |
| 97% |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 205-223-9
RUO – Research Use Only