Learn More
n-Octyltriethoxysilane, 97%
CAS: 2943-75-1 | C14H32O3Si | 276.49 g/mol
Supplier: Thermo Scientific Chemicals 338081000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| n-Octyltriethoxysilane | |
| 2943-75-1 | |
| 100.0 | |
| 0.8800g/mL | |
| 120°C | |
| 97% | |
| C14H32O3Si | |
| CH3(CH2)7Si(OCH2CH3)3 | |
| 100 mL | |
| n-octyltriethoxysilane, octyltriethoxysilane, triethoxy octyl silane, silane, triethoxyoctyl, dynasylan octeo, octyl triethoxy silane, prosil 9202, silquest a 137, prosil 9234, a 137 coupling agent | |
| MSRJTTSHWYDFIU-UHFFFAOYSA-N | |
| triethoxy(octyl)silane | |
| 76262 | |
| 97% |
| 97% | |
| 96.0 | |
| Colorless | |
| 98°C | |
| Authentic | |
| Glass bottle | |
| 1.4160 to 1.418 | |
| MFCD00039883 | |
| 0.88 | |
| Solubility in water: | |
| CCCCCCCC[Si](OCC)(OCC)OCC | |
| 276.49 | |
| 276.49 | |
| Liquid |
Chemical Identifiers
| 2943-75-1 | |
| 276.49 | |
| MSRJTTSHWYDFIU-UHFFFAOYSA-N | |
| 76262 | |
| CCCCCCCC[Si](OCC)(OCC)OCC |
| C14H32O3Si | |
| MFCD00039883 | |
| n-octyltriethoxysilane, octyltriethoxysilane, triethoxy octyl silane, silane, triethoxyoctyl, dynasylan octeo, octyl triethoxy silane, prosil 9202, silquest a 137, prosil 9234, a 137 coupling agent | |
| triethoxy(octyl)silane |
Safety and Handling
GHS H Statement
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Take off contaminated clothing and wash before reuse.
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
EINECSNumber : 220-941-2
RTECSNumber : VV6695500
TSCA : TSCA
RUO – Research Use Only