Learn More
N,O-Bis(trimethylsilyl)trifluoroacetamide, 98+%
CAS: 25561-30-2 | C8H18F3NOSi2 | 257.39 g/mol
Supplier: Thermo Scientific Chemicals 168000050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Silylation reagentSpecifications
| N, O-Bis(trimethylsilyl)trifluoroacetamide | |
| 98.0 | |
| -10.0°C | |
| 0.9600g/mL | |
| 23°C | |
| 98% min. (GC) | |
| C8H18F3NOSi2 | |
| CF3C[=NSi(CH3)3]OSi(CH3)3 | |
| 5 g | |
| bstfa, n,o-bis trimethylsilyl trifluoroacetamide, acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate, trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #, n,o-bis trimethylsilyl trifluoroacetamide bstfa, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate | |
| XCOBLONWWXQEBS-GHXNOFRVSA-N | |
| trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate | |
| 9601896 | |
| 98+% |
| 25561-30-2 | |
| 100.0 | |
| Colorless to Yellow | |
| 45.0°C to 50.0°C (14.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.3829 to 1.3849 | |
| MFCD00008269 | |
| 0.96 | |
| Solubility in water: hydrolyses | |
| C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C | |
| 257.39 | |
| 257.39 | |
| Liquid |
Chemical Identifiers
| 25561-30-2 | |
| 257.39 | |
| XCOBLONWWXQEBS-GHXNOFRVSA-N | |
| 9601896 | |
| C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| C8H18F3NOSi2 | |
| MFCD00008269 | |
| bstfa, n,o-bis trimethylsilyl trifluoroacetamide, acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate, trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #, n,o-bis trimethylsilyl trifluoroacetamide bstfa, trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate | |
| trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Flammable liquid and vapor.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 247-103-9
RUO – Research Use Only