missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N,N,N',N'-Tetramethylbenzidine, 97.5%
CAS: 366-29-0 | C16H20N2 | 240.35 g/mol
Supplier: Thermo Scientific Chemicals 138380250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| N,N,N',N'-Tetramethylbenzidine | |
| 366-29-0 | |
| 100.0 | |
| Brown | |
| 97.50% | |
| C16H20N2 | |
| MFCD00008310 | |
| 13, 221 | |
| YRNWIFYIFSBPAU-UHFFFAOYSA-N | |
| 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline | |
| 9702 | |
| 97.50% |
| 97.5% | |
| 96.5 | |
| 192°C to 196°C | |
| Authentic | |
| Glass bottle | |
| ((CH3)2NC6H4-)2 | |
| 25 g | |
| n,n,n',n'-tetramethylbenzidine, benzidine, n,n,n',n'-tetramethyl, 4,4'-bis n,n-dimethylamino biphenyl, n,n,n',n'-tetramethyl-p,p'-benzidine, ccris 1000, 1,1'-biphenyl-4,4'-diamine, n,n,n',n'-tetramethyl, n,n,n',n'-tetramethyl-1,1'-biphenyl-4,4'-diamine, 4-4-dimethylamino phenyl phenyl dimethylamine, 1,1'-biphenyl-4,4'-diamine, n4,n4,n4',n4'-tetramethyl | |
| CN(C)C1=CC=C(C=C1)C1=CC=C(C=C1)N(C)C | |
| 240.35 | |
| 240.35 | |
| Fine Powder |
Chemical Identifiers
| 366-29-0 | |
| 240.35 | |
| YRNWIFYIFSBPAU-UHFFFAOYSA-N | |
| 9702 | |
| CN(C)C1=CC=C(C=C1)C1=CC=C(C=C1)N(C)C |
| C16H20N2 | |
| MFCD00008310 | |
| n,n,n',n'-tetramethylbenzidine, benzidine, n,n,n',n'-tetramethyl, 4,4'-bis n,n-dimethylamino biphenyl, n,n,n',n'-tetramethyl-p,p'-benzidine, ccris 1000, 1,1'-biphenyl-4,4'-diamine, n,n,n',n'-tetramethyl, n,n,n',n'-tetramethyl-1,1'-biphenyl-4,4'-diamine, 4-4-dimethylamino phenyl phenyl dimethylamine, 1,1'-biphenyl-4,4'-diamine, n4,n4,n4',n4'-tetramethyl | |
| 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline |
Safety and Handling
EINECSNumber : 206-676-5
RTECSNumber : DD1752100
TSCA : TSCA
RUO – Research Use Only