Learn More
N,N'-Bis(3-aminopropyl)-1,3-propanediamine, 94%
CAS: 4605-14-5 | C9H24N4 | 188.32 g/mol
Supplier: Thermo Scientific Chemicals 402280050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| N, N'-Bis(3-aminopropyl)-1, 3-propanediamine | |
| 4605-14-5 | |
| 100.0 | |
| 0.9200g/mL | |
| 110°C | |
| 96% min. (GC) | |
| C9H24N4 | |
| NH2(CH2)3NH(CH2)3NH(CH2)3NH2 | |
| 5 g | |
| norspermine, n,n'-bis 3-aminopropyl-1,3-propanediamine, 1,3-propanediamine, n,n'-bis 3-aminopropyl, n,n'-bis 3-aminopropyl propane-1,3-diamine, 1,5,9,13-tetraazatridecane, 3,3,3-tetramine, thermine, 1,3-propanediamine, n1,n3-bis 3-aminopropyl, n,n-bis 3-aminopropyl-1,3-propanediamine, n1,n1'-propane-1,3-diyl bis propane-1,3-diamine | |
| NCCCNCCCNCCCN | |
| 188.32 | |
| CHEBI:45718 | |
| 97% |
| 97% | |
| 96.0 | |
| Yellow | |
| 102°C (1.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4900 to 1.492 | |
| MFCD00008213 | |
| 0.92 | |
| ZAXCZCOUDLENMH-UHFFFAOYSA-N | |
| (3-aminopropyl)({3-[(3-aminopropyl)amino]propyl})amine | |
| 78350 | |
| 188.32 | |
| Liquid |
Chemical Identifiers
| 4605-14-5 | |
| 188.32 | |
| ZAXCZCOUDLENMH-UHFFFAOYSA-N | |
| 78350 | |
| (3-aminopropyl)({3-[(3-aminopropyl)amino]propyl})amine |
| C9H24N4 | |
| MFCD00008213 | |
| norspermine, n,n'-bis 3-aminopropyl-1,3-propanediamine, 1,3-propanediamine, n,n'-bis 3-aminopropyl, n,n'-bis 3-aminopropyl propane-1,3-diamine, 1,5,9,13-tetraazatridecane, 3,3,3-tetramine, thermine, 1,3-propanediamine, n1,n3-bis 3-aminopropyl, n,n-bis 3-aminopropyl-1,3-propanediamine, n1,n1'-propane-1,3-diyl bis propane-1,3-diamine | |
| CHEBI:45718 | |
| NCCCNCCCNCCCN |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 225-007-8
TSCA : TSCA
RUO – Research Use Only