Learn More
N-Lauroylsarcosine sodium salt, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 434370010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| N-Lauroylsarcosine sodium salt | |
| 94 | |
| 7% max. () | |
| 0.95 | |
| C15H28NO3·Na | |
| 1kg | |
| sarkosyl nl, sodium lauroyl sarcosinate, n-lauroylsarcosine sodium salt, sodium n-lauroylsarcosinate, sodium lauroylsarcosinate, sarcosyl nl, maprosyl 30, compound 105, gardol, hamposyl l-30 | |
| KSAVQLQVUXSOCR-UHFFFAOYSA-M | |
| sodium;2-[dodecanoyl(methyl)amino]acetate | |
| 23668817 | |
| 95% |
| 137-16-6 | |
| 100 | |
| Authentic | |
| Plastic Drum | |
| NaCO2CH2N(CH3)CO(CH2)10CH3 | |
| 154401 | |
| (10% in water) Almost clear colorless to light yellow | |
| CCCCCCCCCCCC(=O)N(C)CC(=O)[O-].[Na+] | |
| 293.39 | |
| 293.39 | |
| Solid |
Safety and Handling
Causes serious eye damage, Fatal if inhaled, Causes skin irritation
Serious eye damage/eye irritation (category 1), Acute toxicity (category 2), Skin corrosion/irritation (category 2)
EINECSNumber : 205-281-5