missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Lauroylsarcosine sodium salt, 95%
CAS: 137-16-6 | C15H28NNaO3 | 293.38 g/mol
$61.40 - $119.09
Chemical Identifiers
| CAS | 137-16-6 |
|---|---|
| Molecular Formula | C15H28NNaO3 |
| Molecular Weight (g/mol) | 293.38 |
| MDL Number | MFCD00042728 |
| InChI Key | KSAVQLQVUXSOCR-UHFFFAOYSA-M |
| Synonym | sarkosyl nl, sodium lauroyl sarcosinate, n-lauroylsarcosine sodium salt, sodium n-lauroylsarcosinate, sodium lauroylsarcosinate, sarcosyl nl, maprosyl 30, compound 105, gardol, hamposyl l-30 |
| PubChem CID | 23668817 |
| IUPAC Name | sodium;2-[dodecanoyl(methyl)amino]acetate |
| SMILES | [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC434370250
|
Thermo Scientific Chemicals
434370250 |
25 g | Glass bottle |
Each for $61.40
|
|
||||
|
AC434371000
|
Thermo Scientific Chemicals
434371000 |
100 g | Glass bottle |
Each for $119.09
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 137-16-6 | |
| 293.38 | |
| KSAVQLQVUXSOCR-UHFFFAOYSA-M | |
| 23668817 | |
| [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O |
| C15H28NNaO3 | |
| MFCD00042728 | |
| sarkosyl nl, sodium lauroyl sarcosinate, n-lauroylsarcosine sodium salt, sodium n-lauroylsarcosinate, sodium lauroylsarcosinate, sarcosyl nl, maprosyl 30, compound 105, gardol, hamposyl l-30 | |
| sodium;2-[dodecanoyl(methyl)amino]acetate |
Specifications
| 137-16-6 | |
| 100 | |
| White | |
| 7% max. () | |
| 0.95 | |
| C15H28NNaO3 | |
| MFCD00042728 | |
| 154401 | |
| (10% in water) Almost clear colorless to light yellow | |
| [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O | |
| 293.38 | |
| 293.39 | |
| Solid |
| 94 | |
| 45.0°C to 47.0°C | |
| 7.0 to 9.0 | |
| Authentic | |
| Glass bottle | |
| NaCO2CH2N(CH3)CO(CH2)10CH3 | |
| 25 g | |
| sarkosyl nl, sodium lauroyl sarcosinate, n-lauroylsarcosine sodium salt, sodium n-lauroylsarcosinate, sodium lauroylsarcosinate, sarcosyl nl, maprosyl 30, compound 105, gardol, hamposyl l-30 | |
| KSAVQLQVUXSOCR-UHFFFAOYSA-M | |
| sodium;2-[dodecanoyl(methyl)amino]acetate | |
| 23668817 | |
| 95% | |
| N-Lauroylsarcosine sodium salt |
Safety and Handling
Causes serious eye damage, Fatal if inhaled, Causes skin irritation
Serious eye damage/eye irritation (category 1), Acute toxicity (category 2), Skin corrosion/irritation (category 2)
EINECSNumber : 205-281-5
RUO – Research Use Only