missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Boc-L-alanine methyl ester, 95%
CAS: 28875-17-4 | C9H17NO4 | 203.24 g/mol
$98.49 - $379.53
Chemical Identifiers
| CAS | 28875-17-4 |
|---|---|
| Molecular Formula | C9H17NO4 |
| Molecular Weight (g/mol) | 203.24 |
| MDL Number | MFCD00038513 |
| InChI Key | GJDICGOCZGRDFM-LURJTMIESA-N |
| Synonym | boc-ala-ome, boc-l-alanine methyl ester, s-n-tert-butoxycarbonylalanine methyl ester, s-methyl 2-tert-butoxycarbonyl amino propanoate, n-boc-l-alanine methyl ester, boc-alanine methyl ester, s-methyl 2-tert-butoxycarbonylamino propanoate, methyl n-tert-butoxycarbonyl-l-alaninate, methyl 2s-2-tert-butoxycarbonyl amino propanoate, methyl 2s-2-tert-butoxy carbonyl amino propanoate |
| PubChem CID | 10856577 |
| IUPAC Name | methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAH6227106
|
Thermo Scientific Chemicals
H6227106 |
5 g |
Each for $98.49
|
|
|||||
|
AAH6227114
|
Thermo Scientific Chemicals
H6227114 |
25 g |
Each for $379.53
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 28875-17-4 | |
| 203.24 | |
| GJDICGOCZGRDFM-LURJTMIESA-N | |
| 10856577 | |
| COC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| C9H17NO4 | |
| MFCD00038513 | |
| boc-ala-ome, boc-l-alanine methyl ester, s-n-tert-butoxycarbonylalanine methyl ester, s-methyl 2-tert-butoxycarbonyl amino propanoate, n-boc-l-alanine methyl ester, boc-alanine methyl ester, s-methyl 2-tert-butoxycarbonylamino propanoate, methyl n-tert-butoxycarbonyl-l-alaninate, methyl 2s-2-tert-butoxycarbonyl amino propanoate, methyl 2s-2-tert-butoxy carbonyl amino propanoate | |
| methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}propanoate |
Specifications
| 32°C to 35°C | |
| White | |
| MFCD00038513 | |
| boc-ala-ome, boc-l-alanine methyl ester, s-n-tert-butoxycarbonylalanine methyl ester, s-methyl 2-tert-butoxycarbonyl amino propanoate, n-boc-l-alanine methyl ester, boc-alanine methyl ester, s-methyl 2-tert-butoxycarbonylamino propanoate, methyl n-tert-butoxycarbonyl-l-alaninate, methyl 2s-2-tert-butoxycarbonyl amino propanoate, methyl 2s-2-tert-butoxy carbonyl amino propanoate | |
| COC(=O)[C@H](C)NC(=O)OC(C)(C)C | |
| methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}propanoate | |
| 203.24 | |
| 10856577 | |
| 95% | |
| N-Boc-L-alanine methyl ester |
| 28875-17-4 | |
| C9H17NO4 | |
| 1872545 | |
| GJDICGOCZGRDFM-LURJTMIESA-N | |
| 1.030 g/mL | |
| 5 g | |
| 113°C (235°F) | |
| 203.24 | |
| Powder |
Safety and Handling
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only