Learn More
N-BOC-1-Aminocyclobutanecarboxylic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 440440050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| N-BOC-1-Aminocyclobutanecarboxylic acid | |
| 96.0 | |
| Authentic | |
| C10H16NO4 | |
| 5g | |
| ROVVUKFHORPDSM-UHFFFAOYSA-M | |
| 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid | |
| 1512646 | |
| 97% |
| 120728-10-1 | |
| 100.0 | |
| 97% | |
| MFCD02682623 | |
| n-boc-1-aminocyclobutanecarboxylic acid, 1-tert-butoxycarbonyl amino cyclobutanecarboxylic acid, 1-boc-amino cyclobutanecarboxylic acid, boc-cyclovaline, boc-acbc-oh, 1-n-boc-amino-cyclobutane carboxylic acid, 1-tert-butoxycarbonylamino cyclobutanecarboxylic acid, boc-1-aminocyclobutane-1-carboxylic acid, n-boc-1-aminocyclobutane carboxylic acid, boc-1-aminocyclobutanecarboxylic acid | |
| CC(C)(C)OC(=O)NC1(CCC1)C([O-])=O | |
| 214.24 | |
| 215.25 |
Chemical Identifiers
| 120728-10-1 | |
| 214.24 | |
| ROVVUKFHORPDSM-UHFFFAOYSA-M | |
| 1512646 | |
| CC(C)(C)OC(=O)NC1(CCC1)C([O-])=O |
| C10H16NO4 | |
| MFCD02682623 | |
| n-boc-1-aminocyclobutanecarboxylic acid, 1-tert-butoxycarbonyl amino cyclobutanecarboxylic acid, 1-boc-amino cyclobutanecarboxylic acid, boc-cyclovaline, boc-acbc-oh, 1-n-boc-amino-cyclobutane carboxylic acid, 1-tert-butoxycarbonylamino cyclobutanecarboxylic acid, boc-1-aminocyclobutane-1-carboxylic acid, n-boc-1-aminocyclobutane carboxylic acid, boc-1-aminocyclobutanecarboxylic acid | |
| 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Wash face,hands and any exposed skin thoroughly after handling.
IF IN EYES.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you fee
GHS Signal Word: Warning
RUO â Research Use Only