missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-Acetyl-D-mannosamine monohydrate, 99%
CAS: 1071625-31-4 | C8H17NO7 | 239.22 g/mol
Supplier: Thermo Scientific Chemicals L1116706
| Quantity | 5 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1071625-31-4 | |
| 239.22 | |
| VVQPUTSNIMAJPT-UHFFFAOYNA-N | |
| 11908605 | |
| O.CC(=O)NC1C(O)OC(CO)C(O)C1O |
| C8H17NO7 | |
| MFCD00149493,MFCD00046758,MFCD00149493,MFCD00069808 | |
| n-acetylmannosamine | |
| N-[(2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
Specifications
| N-Acetyl-D-mannosamine monohydrate | |
| ∼130°C (decomposition) | |
| C8H17NO7 | |
| MFCD00149493,MFCD00046758,MFCD00149493,MFCD00069808 | |
| n-acetylmannosamine | |
| O.CC(=O)NC1C(O)OC(CO)C(O)C1O | |
| 239.22 | |
| 239.24 (221.22 anhydrous) | |
| Powder |
| 1071625-31-4 | |
| Glass bottle | |
| 5 g | |
| 1346524 | |
| VVQPUTSNIMAJPT-UHFFFAOYNA-N | |
| N-[(2R,3S,4S,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide | |
| 11908605 | |
| 99% |
Safety and Handling
TSCA : Yes
Recommended Storage : Keep cold