missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-(2-Hydroxyethyl)phthalimide, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 124920250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| N-(2-Hydroxyethyl)phthalimide | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| MFCD00005903 | |
| 2-1,2,2-trimethylpropylcarbamoyl benzoic acid, 2-3,3-dimethylbutan-2-yl carbamoyl benzoic acid, 2-1,2,2-trimethylpropyl amino carbonyl benzoic acid, n-pinacolylphthalamic acid, 2-3,3-dimethylbutan-2-ylcarbamoyl benzoic acid, +-n-pinacolylphthalamic acid | |
| OCCN1C(=O)C2=CC=CC=C2C1=O | |
| 191.19 | |
| 191.19 |
| 3891-07-4 | |
| 100.0 | |
| 98.5% min. (on dry substance) (HPLC) | |
| C10H9NO3 | |
| 25g | |
| MWFLUYFYHANMCM-UHFFFAOYSA-N | |
| 2-(3,3-dimethylbutan-2-ylcarbamoyl)benzoic acid | |
| 3354762 | |
| 99% |
Chemical Identifiers
| 3891-07-4 | |
| 191.19 | |
| MWFLUYFYHANMCM-UHFFFAOYSA-N | |
| 3354762 | |
| OCCN1C(=O)C2=CC=CC=C2C1=O |
| C10H9NO3 | |
| MFCD00005903 | |
| 2-1,2,2-trimethylpropylcarbamoyl benzoic acid, 2-3,3-dimethylbutan-2-yl carbamoyl benzoic acid, 2-1,2,2-trimethylpropyl amino carbonyl benzoic acid, n-pinacolylphthalamic acid, 2-3,3-dimethylbutan-2-ylcarbamoyl benzoic acid, +-n-pinacolylphthalamic acid | |
| 2-(3,3-dimethylbutan-2-ylcarbamoyl)benzoic acid |
Safety and Handling
EINECSNumber : 223-434-4
RUO â Research Use Only