missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Morin Hydrate 90.0+%, TCI America™
$94.79 - $847.27
Chemical Identifiers
| CAS | 654055-01-3 |
|---|---|
| Molecular Formula | C15H10O7 |
| Molecular Weight (g/mol) | 302.24 |
| MDL Number | MFCD00217054 |
| InChI Key | YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| Synonym | morin hydrate, morinhydrate, bois d,arc hydrate, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate, morin hydrate, powder, morin flavonol, morin hydrate aurantica, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate, 2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone |
| PubChem CID | 16219651 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| SMILES | OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
Chemical Identifiers
| 654055-01-3 | |
| 302.24 | |
| YXOLAZRVSSWPPT-UHFFFAOYSA-N | |
| 16219651 | |
| OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
| C15H10O7 | |
| MFCD00217054 | |
| morin hydrate, morinhydrate, bois d,arc hydrate, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate, morin hydrate, powder, morin flavonol, morin hydrate aurantica, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate, 2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone | |
| 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
Specifications
| 654055-01-3 | |
| MFCD00217054 | |
| 3077 | |
| YXOLAZRVSSWPPT-UHFFFAOYSA-N | |
| 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one | |
| 16219651 | |
| ≥90.0% (HPLC) | |
| Morin Hydrate |
| C15H10O7 | |
| 1 g | |
| morin hydrate, morinhydrate, bois d,arc hydrate, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one hydrate, morin hydrate, powder, morin flavonol, morin hydrate aurantica, 2-2,4-dihydroxyphenyl-3,5,7-trihydroxy-chromen-4-one hydrate, 2 inverted exclamation marka,3,4 inverted exclamation marka,5,7-pentahydroxyflavone | |
| OC1=CC(O)=C(C=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 | |
| 302.24 | |
| 302.24 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (5)-5230
RTECSNumber : LK8749000
TSCA : Yes