missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 3-trifluoromethylbenzoylacetate, 95%, Thermo Scientific™
$178.96 - $178.96
Chemical Identifiers
| CAS | 93618-66-7 |
|---|---|
| Molecular Formula | C11H9F3O3 |
| Molecular Weight (g/mol) | 246.19 |
| MDL Number | MFCD00216522 |
| InChI Key | RPRMYRPHNDGZOY-UHFFFAOYSA-N |
| Synonym | methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester |
| PubChem CID | 735880 |
| IUPAC Name | methyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC425450025
|
Thermo Scientific Chemicals
425450025 |
2.5 g | Glass bottle |
Each for $178.96
|
|
||||
Chemical Identifiers
| 93618-66-7 | |
| 246.19 | |
| RPRMYRPHNDGZOY-UHFFFAOYSA-N | |
| 735880 | |
| COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F |
| C11H9F3O3 | |
| MFCD00216522 | |
| methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester | |
| methyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
Specifications
| 93618-66-7 | |
| 94°C to 96°C (0.2 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4864 to 1.4884 | |
| 2.5 g | |
| Solubility in water: neglegible in water | |
| COC(=O)CC(=O)C1=CC=CC(=C1)C(F)(F)F | |
| 246.19 | |
| 246.18 | |
| Liquid |
| Yellow | |
| >200°C | |
| 94% min. (HPLC) | |
| C11H9F3O3 | |
| MFCD00216522 | |
| methyl 3-oxo-3-3-trifluoromethyl phenyl propanoate, methyl 3-trifluoromethyl benzoylacetate, methyl 3-trifluoromethyl benzoyl acetate, 3-3-trifluoromethylphenyl-3-oxo-propionic acid methyl ester, 3-oxo-3-3-trifluoromethyl-phenyl-propionic acid methyl ester, pubchem2695, methyl 3-trifluoromethylbenzoylacetate, methyl 3-oxo-3-3-trifluoromethylphenyl propanoate, 3-oxo-3-3-trifluoromethylphenyl propionic acid methyl ester | |
| RPRMYRPHNDGZOY-UHFFFAOYSA-N | |
| methyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate | |
| 735880 | |
| 95% | |
| Methyl 3-trifluoromethylbenzoylacetate |
RUO – Research Use Only