Learn More
Thermo Scientific Chemicals Betamethasone, 97%
CAS: 378-44-9 | C22H29FO5 | 392.46 g/mol
$209.14 - $904.24
Chemical Identifiers
| CAS | 378-44-9 |
|---|---|
| Molecular Formula | C22H29FO5 |
| Molecular Weight (g/mol) | 392.46 |
| InChI Key | UREBDLICKHMUKA-DVTGEIKXSA-N |
| Synonym | betamethasone, betadexamethasone, flubenisolone, celestone, betamethazone, rinderon, betacorlan, betacortril, betamamallet, betametasone |
| PubChem CID | 9782 |
| ChEBI | CHEBI:3077 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC459070050
|
Thermo Scientific Chemicals
459070050 |
5 g |
Each for $209.14
|
|
|||||
|
AC459070250
|
Thermo Scientific Chemicals
459070250 |
25 g |
Each for $904.24
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 378-44-9 | |
| 392.46 | |
| betamethasone, betadexamethasone, flubenisolone, celestone, betamethazone, rinderon, betacorlan, betacortril, betamamallet, betametasone | |
| CHEBI:3077 | |
| CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |
| C22H29FO5 | |
| UREBDLICKHMUKA-DVTGEIKXSA-N | |
| 9782 | |
| (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
Specifications
| 378-44-9 | |
| Authentic | |
| C22H29FO5 | |
| betamethasone, betadexamethasone, flubenisolone, celestone, betamethazone, rinderon, betacorlan, betacortril, betamamallet, betametasone | |
| UREBDLICKHMUKA-DVTGEIKXSA-N | |
| (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | |
| 9782 | |
| 392.46 | |
| βmethasone |
| 0.5% max. | |
| 96% min. (HPLC) | |
| 5 g | |
| Solubility in water: slightly soluble. | |
| CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C | |
| 392.46 | |
| CHEBI:3077 | |
| 97% |
Safety and Handling
GHS H Statement
May damage the unborn child.
May cause damage to organs through prolonged or repeated exposure.
GHS P Statement
Obtain special instructions before use.
Use personal protective equipment as required.
IF exposed or concerned: Get medical advice/attention.
Do not breathe dust/fume/gas/mist/vapors/spray.
GHS Signal Word: Danger
EINECSNumber : 206-825-4
RUO – Research Use Only