missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methacroylcholine Chloride (ca. 80% in Water) (stabilized with MEHQ), TCI America™
Supplier: TCI America M091825G
Specifications
| Methacroylcholine Chloride (ca. 80% in Water) (stabilized with MEHQ) | |
| Yellow | |
| MFCD00060097 | |
| polyquaternium-37, 2-methacryloyloxy-n,n,n-trimethylethanaminium chloride, unii-pp88r88k3o, methacrylatoethyl trimethyl ammonium chloride, 2-methacryloyloxy ethyl trimethylammonium chloride, 2-methacryloyloxy ethyl trimethylammonium, methacryloxyethyltrimethyl ammonium chloride, ethanaminium, n,n,n-trimethyl-2-2-methyl-1-oxo-2-propenyl oxy-, chloride | |
| CC(=C)C(=O)OCC[N+](C)(C)C.[Cl-] | |
| 207.698 | |
| 207.70 |
| 5039-78-1 | |
| C9H18ClNO2 | |
| 25 g | |
| RRHXZLALVWBDKH-UHFFFAOYSA-M | |
| trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride | |
| 78738 | |
| Liquid |
Chemical Identifiers
| 5039-78-1 | |
| 207.698 | |
| RRHXZLALVWBDKH-UHFFFAOYSA-M | |
| 78738 | |
| CC(=C)C(=O)OCC[N+](C)(C)C.[Cl-] |
| C9H18ClNO2 | |
| MFCD00060097 | |
| polyquaternium-37, 2-methacryloyloxy-n,n,n-trimethylethanaminium chloride, unii-pp88r88k3o, methacrylatoethyl trimethyl ammonium chloride, 2-methacryloyloxy ethyl trimethylammonium chloride, 2-methacryloyloxy ethyl trimethylammonium, methacryloxyethyltrimethyl ammonium chloride, ethanaminium, n,n,n-trimethyl-2-2-methyl-1-oxo-2-propenyl oxy-, chloride | |
| trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride |
Safety and Handling
TSCA : Yes