missing translation for 'onlineSavingsMsg'
Learn More
Learn More
meso-1,2-Diphenyl-1,2-ethanediol, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 247680050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| meso-1, 2-Diphenyl-1, 2-ethanediol | |
| Authentic | |
| Glass bottle | |
| C6H5CH(OH)CH(OH)C6H5 | |
| 5g | |
| Solubility in water: insoluble. | |
| OC(C(O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 214.26 | |
| CHEBI:50015 | |
| 95% |
| 579-43-1 | |
| 94% min. (GC) | |
| C14H14O2 | |
| MFCD00064253 | |
| meso-hydrobenzoin, meso-1,2-diphenyl-1,2-ethanediol, unii-co9a49a84i, meso-stilbene glycol, 1r,2s-1,2-diphenylethane-1,2-diol, meso-1,2-diphenylethylene glycol, hydrobenzoin, meso, unii-q61g3433lb component | |
| IHPDTPWNFBQHEB-UHFFFAOYNA-N | |
| (1R,2S)-1,2-diphenylethane-1,2-diol | |
| 853018 | |
| 214.26 |
Chemical Identifiers
| 579-43-1 | |
| 214.26 | |
| IHPDTPWNFBQHEB-UHFFFAOYNA-N | |
| 853018 | |
| (1R,2S)-1,2-diphenylethane-1,2-diol |
| C14H14O2 | |
| MFCD00064253 | |
| meso-hydrobenzoin, meso-1,2-diphenyl-1,2-ethanediol, unii-co9a49a84i, meso-stilbene glycol, 1r,2s-1,2-diphenylethane-1,2-diol, meso-1,2-diphenylethylene glycol, hydrobenzoin, meso, unii-q61g3433lb component | |
| CHEBI:50015 | |
| OC(C(O)C1=CC=CC=C1)C1=CC=CC=C1 |
RUO â Research Use Only