Learn More
Manganese(II) nitrate hydrate, Puratronic™, 99.995% (metals basis)
CAS: 15710-66-4 | MnN2O6 | 178.95 g/mol
$47.30 - $607.26
Chemical Identifiers
| CAS | 15710-66-4 |
|---|---|
| Molecular Formula | MnN2O6 |
| Molecular Weight (g/mol) | 178.95 |
| MDL Number | MFCD00149788 |
| InChI Key | MIVBAHRSNUNMPP-UHFFFAOYSA-N |
| Synonym | manganese ii nitrate hydrate, acmc-1brrd, manganese nitrate hydrate, mn.2no3.h2o, manganese 2+ ion hydrate dinitrate, manganese 2+ hydrate dinitrate, manganese ii nitrate hydrate, puratronic, manganese 2+ nitrate-water 1/2/1 |
| PubChem CID | 16211480 |
| SMILES | [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA1080604
|
Thermo Scientific Chemicals
01080604 |
2 g |
Each for $47.30
|
|
|||||
|
AA1080609
|
Thermo Scientific Chemicals
01080609 |
10 g |
Each for $145.11
|
|
|||||
|
AA1080618
|
Thermo Scientific Chemicals
01080618 |
50 g |
Each for $607.26
|
|
|||||
Description
Raw material for electrochemical synthesis of a LaMnO3 thin film coating on stainless steel substrates. Also useful precursors to the oxides of manganese.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 15710-66-4 | |
| 178.95 | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| 16211480 |
| MnN2O6 | |
| MFCD00149788 | |
| manganese ii nitrate hydrate, acmc-1brrd, manganese nitrate hydrate, mn.2no3.h2o, manganese 2+ ion hydrate dinitrate, manganese 2+ hydrate dinitrate, manganese ii nitrate hydrate, puratronic, manganese 2+ nitrate-water 1/2/1 | |
| [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
Specifications
| ∽26°C | |
| Pink | |
| 2 g | |
| MnN2O6 | |
| manganese ii nitrate hydrate, acmc-1brrd, manganese nitrate hydrate, mn.2no3.h2o, manganese 2+ ion hydrate dinitrate, manganese 2+ hydrate dinitrate, manganese ii nitrate hydrate, puratronic, manganese 2+ nitrate-water 1/2/1 | |
| MIVBAHRSNUNMPP-UHFFFAOYSA-N | |
| manganese(2+);dinitrate;hydrate | |
| 16211480 | |
| Odorless | |
| Pink Crystalline Aggregates |
| 15710-66-4 | |
| Crystalline Aggregates | |
| 99.999% (Metal basis) | |
| MFCD00149788 | |
| Soluble in water. | |
| [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 178.95 | |
| 178.95 (Anhydrous) | |
| Hygroscopic | |
| Manganese(II) nitrate hydrate |
Safety and Handling
P210-P220-P221-P260-P264b-P270-P271-P280-P284-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P370+P378q-P501c
H272-H302-H314-H373
DOTInformation : DOT Class: 5.1, Packaging Group: III
EINECSNumber : 233-828-8
TSCA : Yes
Recommended Storage : Ambient temperatures; Store under Argon
RUO – Research Use Only