missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Magnesium Perchlorate, Desiccant, ACS, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor M1060500GM
Specifications
| 10034-81-8 | |
| 500 g | |
| MPCRDALPQLDDFX-UHFFFAOYSA-L | |
| magnesium(2+) diperchlorate | |
| ACS | |
| Amber Glass Bottle |
| 1 | |
| Cl2MgO8 | |
| [Mg++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O | |
| 223.20 | |
| 0.08 |
Chemical Identifiers
| 10034-81-8 | |
| 223.20 | |
| magnesium(2+) diperchlorate |
| Cl2MgO8 | |
| MPCRDALPQLDDFX-UHFFFAOYSA-L | |
| [Mg++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.