missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Magnesium Gluconate, USP, 98-102%, Spectrum™ Chemical
MA112, 3632-91-5, C12H22MgO14
Supplier: Spectrum Chemical Mfg Cor MA11212KG
Description
Spectrum™ Chemical Magnesium Gluconate, USP is an essential mineral and used in treating low magnesium levels or maintaining the proper amount of magnesium in the body. All Spectrum Chemical USP grade products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 3632-91-5 | |
| 6.0-7.8 | |
| C12H22MgO14 | |
| CTUVIUYTHWPELF-IYEMJOQQSA-L | |
| magnesium(2+) bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) | |
| 98 to 102% | |
| Poly Pail |
| 100% | |
| 12 kg | |
| MFCD00150971 | |
| [Mg++].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O | |
| 414.60 | |
| USP |
Chemical Identifiers
| 3632-91-5 | |
| 414.60 | |
| CTUVIUYTHWPELF-IYEMJOQQSA-L | |
| [Mg++].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O |
| C12H22MgO14 | |
| MFCD00150971 | |
| magnesium(2+) bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) |