missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lithium Tetraborate, Honeywell™
≥99.9% trace metals basis
Supplier: Honeywell Chemicals 2225341KG
Description
- We are your supplier of high-quality lab reagents and chemicals for analytical and chemistry laboratories:
Solvents – ACS specific use (HPLC), ACS general use, solvents for histology, and reagent grade for chemical synthesis and other industrial applications.
Inorganics – Chemical synthesis and inorganic chemistry including essential acids and bases, salts, metals and elements, and reagents for chemical reactions.
Specifications
| Lithium Tetraborate | |
| 1 kg | |
| Li2B4O7 | |
| NONH for all modes of transport | |
| [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 | |
| 169.11 | |
| ≥99.9% (trace metals basis) |
| 12007-60-2 | |
| B4Li2O7 | |
| MFCD00011083 | |
| RDZCISUGRQUANA-UHFFFAOYSA-N | |
| dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) | |
| 169.12g/mol | |
| ≥0.25g/mL at 25°C |
Chemical Identifiers
| 12007-60-2 | |
| 169.11 | |
| RDZCISUGRQUANA-UHFFFAOYSA-N | |
| [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| B4Li2O7 | |
| MFCD00011083 | |
| dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) |
Safety and Handling
EINECSNumber : 234-514-3