Learn More
Lithium bis(trimethylsilyl)amide, 95%
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
$68.16 - $870.26
Chemical Identifiers
| CAS | 4039-32-1 |
|---|---|
| Molecular Formula | C6H18LiNSi2 |
| Molecular Weight (g/mol) | 167.33 |
| MDL Number | MFCD00008261 |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Synonym | lithium bis trimethylsilyl amide, lithium hexamethyldisilazide, lihmds, lhmds, hexamethyldisilazane lithium salt, unii-rc4n1i108m, lithiumbis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium hexamethyldisilazane, lithium bis-trimethylsilyl amide |
| PubChem CID | 2733832 |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC338140100
|
Thermo Scientific Chemicals
338140100 |
10 g | Glass bottle |
Each for $68.16
|
|
||||
|
AC338140500
|
Thermo Scientific Chemicals
338140500 |
50 g | Glass bottle |
Each for $200.85
|
|
||||
|
AC338142500
|
Thermo Scientific Chemicals
338142500 |
250 g | Glass bottle |
Each for $870.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4039-32-1 | |
| 167.33 | |
| YNESATAKKCNGOF-UHFFFAOYSA-N | |
| 2733832 | |
| [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| C6H18LiNSi2 | |
| MFCD00008261 | |
| lithium bis trimethylsilyl amide, lithium hexamethyldisilazide, lihmds, lhmds, hexamethyldisilazane lithium salt, unii-rc4n1i108m, lithiumbis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium hexamethyldisilazane, lithium bis-trimethylsilyl amide | |
| lithium;bis(trimethylsilyl)azanide |
Specifications
| 4039-32-1 | |
| 0.8910g/mL | |
| Authentic | |
| Glass bottle | |
| [(CH3)3Si]2NLi | |
| 10 g | |
| 0.891 | |
| Solubility in water: decomposes | |
| [Li+].C[Si](C)(C)[N-][Si](C)(C)C | |
| 167.33 | |
| 167.33 | |
| Crystalline Powder and/or Chunks |
| Yellow | |
| 114°C to 116°C | |
| 95% | |
| C6H18LiNSi2 | |
| MFCD00008261 | |
| 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 | |
| lithium bis trimethylsilyl amide, lithium hexamethyldisilazide, lihmds, lhmds, hexamethyldisilazane lithium salt, unii-rc4n1i108m, lithiumbis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium hexamethyldisilazane, lithium bis-trimethylsilyl amide | |
| YNESATAKKCNGOF-UHFFFAOYSA-N | |
| lithium;bis(trimethylsilyl)azanide | |
| 2733832 | |
| 95% | |
| Lithium bis(trimethylsilyl)amide |
Safety and Handling
GHS H Statement
Flammable solid.
Causes severe skin burns and eye damage.
Reacts violently with water.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse
GHS Signal Word: Danger
EINECSNumber : 223-725-6
RUO – Research Use Only