missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Light Green SF, Yellowish, pure, high purity biological stain
CAS: 5141-20-8 | C37H34N2Na2O9S3 | 792.844 g/mol
Supplier: Thermo Scientific Chemicals 229771000
| Quantity | 100 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 5141-20-8 | |
| 792.844 | |
| DGOBMKYRQHEFGQ-UHFFFAOYSA-L | |
| 21223 | |
| disodium;3-[[N-ethyl-4-[[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-(4-sulfonatophenyl)methyl]anilino]methyl]benzenesulfonate |
| C37H34N2Na2O9S3 | |
| MFCD00012121 | |
| Acid Green 5, C.I. 42095 | |
| CHEBI:87065 | |
| CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=C(C=C5)S(=O)(=O)[O-].[Na+].[Na+] |
Specifications
| Light Green SF, Yellowish | |
| Pure | |
| 0.96 to 1.16 | |
| MFCD00012121 | |
| 15, 5538 | |
| Solubility in water: 200g/L water (20°C). Other solubilities: soluble in alcohol | |
| CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=C(C=C5)S(=O)(=O)[O-].[Na+].[Na+] | |
| disodium;3-[[N-ethyl-4-[[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-(4-sulfonatophenyl)methyl]anilino]methyl]benzenesulfonate | |
| 21223 | |
| 629 to 634nm (H2O, 5mg/L, 1cm) | |
| 10% max. (1 g, 110°C, 2 hrs) | |
| Pure | |
| Complies | |
| 100 g |
| 288.0°C | |
| 5141-20-8 | |
| C37H34N2Na2O9S3 | |
| 14, 856 | |
| Acid Green 5, C.I. 42095 | |
| DGOBMKYRQHEFGQ-UHFFFAOYSA-L | |
| Authentic | |
| 792.844 | |
| CHEBI:87065 | |
| 792.84 | |
| ≥60% (TiCl3-titr.) (on substance as is) | |
| Glass bottle | |
| Purple | |
| Powder, Crystals or Crystalline Powder |