missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lead(Ii) Nitrate, ACS Reagent, Honeywell Fluka™
ACS Reagent,≥99.0%
Supplier: Honeywell-Fluka 22862125KG
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Lead(Ii) Nitrate | |
| 2.5 kg | |
| Pb(NO3)2 | |
| 1469 | |
| RLJMLMKIBZAXJO-UHFFFAOYSA-N | |
| lead(2+);dinitrate | |
| 24924 | |
| 331.21g/mol | |
| ACS Reagent |
| 10099-74-8 | |
| N2O6Pb | |
| MFCD00011153 | |
| lead dinitrate, lead nitrate, lead ii nitrate, plumbous nitrate, lead 2+ nitrate, lead nitrate pb no3 2, nitrate de plomb french, lead ii nitrate 1:2, nitric acid, lead 2+ salt | |
| [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 331.20 | |
| CHEBI:37187 | |
| ≥99% |
Chemical Identifiers
| 10099-74-8 | |
| 331.20 | |
| RLJMLMKIBZAXJO-UHFFFAOYSA-N | |
| 24924 | |
| lead(2+);dinitrate |
| N2O6Pb | |
| MFCD00011153 | |
| lead dinitrate, lead nitrate, lead ii nitrate, plumbous nitrate, lead 2+ nitrate, lead nitrate pb no3 2, nitrate de plomb french, lead ii nitrate 1:2, nitric acid, lead 2+ salt | |
| CHEBI:37187 |
Safety and Handling
P201-P210-P220-P280-P305 + P351 + P338 + P310-P308 + P313
H272-H302 + H332-H318-H360Df-H373-H410
EINECSNumber : 233-245-9
RTECSNumber : OG2100000