missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lamivudine, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 461090010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Lamivudine | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| Solubility in water: 70g/L (20°C). | |
| C1C(OC(S1)CO)N2C=CC(=NC2=O)N | |
| 229.26 | |
| CHEBI:63577 | |
| 98% |
| 134678-17-4 | |
| 97.5% min. (HPLC) | |
| C8H11N3O3S | |
| lamivudine, epivir, zeffix, heptovir, epivir-hbv, hepitec, heptodin, 2',3'-dideoxy-3'-thiacytidine, lamivir, 3tc | |
| JTEGQNOMFQHVDC-NKWVEPMBSA-N | |
| 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one | |
| 60825 | |
| 229.26 |
Chemical Identifiers
| 134678-17-4 | |
| 229.26 | |
| lamivudine, epivir, zeffix, heptovir, epivir-hbv, hepitec, heptodin, 2',3'-dideoxy-3'-thiacytidine, lamivir, 3tc | |
| CHEBI:63577 | |
| C1C(OC(S1)CO)N2C=CC(=NC2=O)N |
| C8H11N3O3S | |
| JTEGQNOMFQHVDC-NKWVEPMBSA-N | |
| 60825 | |
| 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
Safety and Handling
Suspected of damaging fertility or the unborn child, May cause damage to organs through prolonged or repeated exposure
Reproductive toxicity (category 2), Specific target organ toxicity after repeated exposure (category 2)
RUO â Research Use Only