missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Lactose, Monohydrate, Powder, N.F., J.T. Baker™
Supplier: Avantor J.T.Baker 224905
Specifications
| Lactose | |
| 64044-51-5 | |
| C12H24O12 | |
| 1L = 1.53kg | |
| WSVLPVUVIUVCRA-ZEAJSSQNSA-N | |
| (3S,6R)-2-(hydroxymethyl)-6-[(3R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;hydrate | |
| 133126686 | |
| NF |
| Monohydrate | |
| Poly Bottle | |
| 2.5 kg | |
| d-lactose monohydrate, d-+-lactosemonohydrate | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O | |
| 360.312 | |
| 360.32 | |
| Powder |
Chemical Identifiers
| 64044-51-5 | |
| 360.312 | |
| d-lactose monohydrate, d-+-lactosemonohydrate | |
| (3S,6R)-2-(hydroxymethyl)-6-[(3R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;hydrate |
| C12H24O12 | |
| WSVLPVUVIUVCRA-ZEAJSSQNSA-N | |
| 133126686 | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O |