Learn More
L-Tyrosine methyl ester hydrochloride, 98+%
CAS: 3417-91-2 | C10H14ClNO3 | 231.68 g/mol
$105.16 - $289.00
Chemical Identifiers
| CAS | 3417-91-2 |
|---|---|
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight (g/mol) | 231.68 |
| MDL Number | MFCD00012607 |
| InChI Key | VXYFARNRGZWHTJ-MVRPGTNWNA-N |
| Synonym | l-tyrosine methyl ester hydrochloride, h-tyr-ome.hcl, methyl l-tyrosinate hydrochloride, h-tyr-ome hcl, methyl tyrosinate hydrochloride, unii-w42m0mi271, tyrosine methyl ester hydrochloride, methyl l-tyrosinate hcl, s-methyl 2-amino-3-4-hydroxyphenyl propanoate hydrochloride, s-2-amino-3-4-hydroxy-phenyl-propionic acid methyl ester hydrochloride |
| PubChem CID | 76956 |
| IUPAC Name | methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | Cl.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2268314
|
Thermo Scientific Chemicals
B2268314 |
25 g |
Each for $105.16
|
|
|||||
|
AAB2268322
|
Thermo Scientific Chemicals
B2268322 |
100 g |
Each for $289.00
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3417-91-2 | |
| 231.68 | |
| VXYFARNRGZWHTJ-MVRPGTNWNA-N | |
| 76956 | |
| Cl.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 |
| C10H14ClNO3 | |
| MFCD00012607 | |
| l-tyrosine methyl ester hydrochloride, h-tyr-ome.hcl, methyl l-tyrosinate hydrochloride, h-tyr-ome hcl, methyl tyrosinate hydrochloride, unii-w42m0mi271, tyrosine methyl ester hydrochloride, methyl l-tyrosinate hcl, s-methyl 2-amino-3-4-hydroxyphenyl propanoate hydrochloride, s-2-amino-3-4-hydroxy-phenyl-propionic acid methyl ester hydrochloride | |
| methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
Specifications
| 187°C (decomposition) | |
| C10H14ClNO3 | |
| 3917353 | |
| VXYFARNRGZWHTJ-MVRPGTNWNA-N | |
| methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride | |
| 231.68 | |
| −5.2° (c= 2.4 in Water) | |
| Hygroscopic | |
| L-Tyrosine methyl ester hydrochloride |
| 3417-91-2 | |
| MFCD00012607 | |
| l-tyrosine methyl ester hydrochloride, h-tyr-ome.hcl, methyl l-tyrosinate hydrochloride, h-tyr-ome hcl, methyl tyrosinate hydrochloride, unii-w42m0mi271, tyrosine methyl ester hydrochloride, methyl l-tyrosinate hcl, s-methyl 2-amino-3-4-hydroxyphenyl propanoate hydrochloride, s-2-amino-3-4-hydroxy-phenyl-propionic acid methyl ester hydrochloride | |
| Cl.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 | |
| 25 g | |
| 76956 | |
| 231.68 | |
| ≥98% |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 222-313-3
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only