missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Tryptophan methyl ester hydrochloride, 98%
CAS: 7524-52-9 | C12H15ClN2O2 | 254.71 g/mol
$279.85 - $279.85
Chemical Identifiers
| CAS | 7524-52-9 |
|---|---|
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight (g/mol) | 254.71 |
| MDL Number | MFCD00066134 |
| InChI Key | XNFNGGQRDXFYMM-PPHPATTJSA-N |
| Synonym | l-tryptophan methyl ester hydrochloride, h-trp-ome.hcl, methyl l-tryptophanate hydrochloride, methyl tryptophanate hydrochloride, methyl l-tryptophanate hcl, unii-au62o6861l, methyl 2s-2-amino-3-1h-indol-3-yl propanoate hydrochloride, s-methyl 2-amino-3-1h-indol-3-yl propanoate hydrochloride, l-tryptophanmethylesterhydrochloride, l-tryptophan methyl ester hcl |
| PubChem CID | 2734891 |
| IUPAC Name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
| SMILES | Cl.COC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC376650250
|
Thermo Scientific Chemicals
376650250 |
25 g | Glass Bottle |
Each for $279.85
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 7524-52-9 | |
| 254.71 | |
| XNFNGGQRDXFYMM-PPHPATTJSA-N | |
| 2734891 | |
| Cl.COC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12 |
| C12H15ClN2O2 | |
| MFCD00066134 | |
| l-tryptophan methyl ester hydrochloride, h-trp-ome.hcl, methyl l-tryptophanate hydrochloride, methyl tryptophanate hydrochloride, methyl l-tryptophanate hcl, unii-au62o6861l, methyl 2s-2-amino-3-1h-indol-3-yl propanoate hydrochloride, s-methyl 2-amino-3-1h-indol-3-yl propanoate hydrochloride, l-tryptophanmethylesterhydrochloride, l-tryptophan methyl ester hcl | |
| methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride |
Specifications
| 218.0°C to 220.0°C | |
| White | |
| 98% | |
| Glass Bottle | |
| + 18.00 | |
| XNFNGGQRDXFYMM-PPHPATTJSA-N | |
| methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride | |
| 25 g | |
| 2734891 | |
| 98% | |
| L-Tryptophan methyl ester hydrochloride |
| 7524-52-9 | |
| Authentic | |
| C12H15ClN2O2 | |
| MFCD00066134 | |
| l-tryptophan methyl ester hydrochloride, h-trp-ome.hcl, methyl l-tryptophanate hydrochloride, methyl tryptophanate hydrochloride, methyl l-tryptophanate hcl, unii-au62o6861l, methyl 2s-2-amino-3-1h-indol-3-yl propanoate hydrochloride, s-methyl 2-amino-3-1h-indol-3-yl propanoate hydrochloride, l-tryptophanmethylesterhydrochloride, l-tryptophan methyl ester hcl | |
| Cl.COC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12 | |
| + 18.00 (20.00°C c=5 CH3OH) | |
| 254.71 | |
| 254.72 | |
| Powder |
RUO – Research Use Only