missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L-Tryptophan, Cell Culture Reagent
CAS: 73-22-3 | C11H12N2O2 | 204.23 g/mol
$60.55 - $1329.27
Chemical Identifiers
| CAS | 73-22-3 |
|---|---|
| Molecular Formula | C11H12N2O2 |
| Molecular Weight (g/mol) | 204.23 |
| MDL Number | MFCD00064340 |
| InChI Key | QIVBCDIJIAJPQS-VIFPVBQESA-N |
| Synonym | l-tryptophan, tryptophan, l-tryptophane, s-tryptophan, tryptophane, h-trp-oh, optimax, trofan, tryptacin, ardeytropin |
| PubChem CID | 6305 |
| ChEBI | CHEBI:16828 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6250809
|
Thermo Scientific Chemicals
J6250809 |
10 g |
Each for $60.55
|
|
|||||
|
AAJ6250822
|
Thermo Scientific Chemicals
J6250822 |
100 g |
Each for $257.74
|
|
|||||
|
AAJ62508A1
|
Thermo Scientific Chemicals
J62508A1 |
1 kg |
Each for $1,329.27
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 73-22-3 | |
| 204.23 | |
| QIVBCDIJIAJPQS-VIFPVBQESA-N | |
| 6305 | |
| (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| C11H12N2O2 | |
| MFCD00064340 | |
| l-tryptophan, tryptophan, l-tryptophane, s-tryptophan, tryptophane, h-trp-oh, optimax, trofan, tryptacin, ardeytropin | |
| CHEBI:16828 | |
| N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O |
Specifications
| 280°C to 285°C | |
| White | |
| MFCD00064340 | |
| 14,9797 | |
| QIVBCDIJIAJPQS-VIFPVBQESA-N | |
| (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid | |
| 204.23 | |
| CHEBI:16828 | |
| Cell Culture Reagent | |
| L-Tryptophan |
| 73-22-3 | |
| C11H12N2O2 | |
| 86197 | |
| l-tryptophan, tryptophan, l-tryptophane, s-tryptophan, tryptophane, h-trp-oh, optimax, trofan, tryptacin, ardeytropin | |
| N[C@@H](CC1=CNC2=CC=CC=C12)C(O)=O | |
| 10 g | |
| 6305 | |
| 204.23 | |
| Powder |
Safety and Handling
EINECSNumber : 200-795-6
RTECSNumber : YN6130000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only