missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Tryptophan, ≥99%, MP Biomedicals™
L-Tryptophan is an amino acid precursor of serotonin and melatonin
Supplier: Mp Biomedicals 0210315125
Specifications
| L-Tryptophan | |
| ≥99% | |
| MFCD00064340 | |
| QIVBCDIJIAJPQS-VIFPVBQESA-N | |
| (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid | |
| 6305 | |
| 204.22 | |
| White |
| 73-22-3 | |
| C11H12N2O2 | |
| ardeytropin, h-trp-oh, l-tryptophan, l-tryptophane, optimax, s-tryptophan, trofan, tryptacin, tryptophan, tryptophane | |
| C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N | |
| 204.229 | |
| CHEBI:16828 | |
| Crystalline Powder | |
| 25g |
Chemical Identifiers
| 73-22-3 | |
| 204.229 | |
| QIVBCDIJIAJPQS-VIFPVBQESA-N | |
| 6305 | |
| (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| C11H12N2O2 | |
| MFCD00064340 | |
| ardeytropin, h-trp-oh, l-tryptophan, l-tryptophane, optimax, s-tryptophan, trofan, tryptacin, tryptophan, tryptophane | |
| CHEBI:16828 | |
| C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
Safety and Handling
EINECSNumber : 200-795-6
Recommended Storage : Store at Room temperature (15 to 30°C).